![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | asset/ | 2017-02-17 03:24 | - | |
![[DIR]](/icons/folder.gif) | css/ | 2017-02-17 03:24 | - | |
![[DIR]](/icons/folder.gif) | js/ | 2017-02-17 03:24 | - | |
![[TXT]](/icons/text.gif) | manifest-hm_f12_osu.tsv | 2017-02-17 03:24 | 3.8K | |
![[TXT]](/icons/text.gif) | hmosu-volumetric analysis_1.html | 2017-02-17 03:24 | 4.7K | |
![[TXT]](/icons/text.gif) | hmosu-use of electronic balances_1.html | 2017-02-17 03:24 | 4.7K | |
![[ ]](/icons/unknown.gif) | manifest-hm_f12_osu.xml | 2017-02-17 03:24 | 4.9K | |
![[TXT]](/icons/text.gif) | hmosu-use of the spectroscope_1.html | 2017-02-17 03:24 | 5.2K | |
![[TXT]](/icons/text.gif) | hmosu-calorimetry and hess law_1.html | 2017-02-17 03:24 | 5.2K | |
![[TXT]](/icons/text.gif) | hmosu-determination of a zinc ion_1.html | 2017-02-17 03:24 | 5.2K | |
![[TXT]](/icons/text.gif) | hmosu-vapor pressure and enthalpy of vaporization_1.html | 2017-02-17 03:24 | 5.3K | |
![[TXT]](/icons/text.gif) | hmosu-reactions and qualitative determination of selected metal ions_1.html | 2017-02-17 03:24 | 5.3K | |
![[TXT]](/icons/text.gif) | hmosu-experiment tabbed video template_1.html | 2017-02-17 03:24 | 5.6K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 20 use of ph meter_1.html | 2017-02-17 03:24 | 5.6K | |
![[TXT]](/icons/text.gif) | hmosu-vapor density and the gas laws_1.html | 2017-02-17 03:24 | 5.7K | |
![[TXT]](/icons/text.gif) | hmosu-stoichiometry and the chemical equation_1.html | 2017-02-17 03:24 | 5.8K | |
![[TXT]](/icons/text.gif) | hmosu-determination of the empirical formula of a compound_1.html | 2017-02-17 03:24 | 6.3K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 17 temperature dependence of a rate constant_1.html | 2017-02-17 03:24 | 6.9K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 18 equilibria in chemical reactions_1.html | 2017-02-17 03:24 | 7.0K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 19 quantitative analysis of a solution of two acids_1.html | 2017-02-17 03:24 | 7.1K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 15 freezing point depression_1.html | 2017-02-17 03:24 | 7.1K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 23 voltaic_1.html | 2017-02-17 03:24 | 7.2K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 16 determining a rate law and rate constant_1.html | 2017-02-17 03:24 | 7.6K | |
![[TXT]](/icons/text.gif) | manifest-hm_f12_osu.html | 2017-02-17 03:24 | 7.6K | |
![[TXT]](/icons/text.gif) | hmosu-experiment 23 electrolytic_1.html | 2017-02-17 03:24 | 7.9K | |
![[TXT]](/icons/text.gif) | hmosu-safety in the chemistry laboratory_1.html | 2017-02-17 03:24 | 14K | |
|